C23H29N3O6S3 — CID 71101240
[4-[(2S)-2-[2-(2,3-dihydrothiophen-2-yl)-1,3-thiazol-4-yl]-2-[[(2S)-2-methoxycarbonyl-4-methylpentanoyl]amino]ethyl]phenyl]sulfamic acid (PubChem CID 71101240) has the molecular formula C23H29N3O6S3 and a molecular weight of 539.70 g/mol. Its IUPAC name is [4-[(2S)-2-[2-(2,3-dihydrothiophen-2-yl)-1,3-thiazol-4-yl]-2-[[(2S)-2-methoxycarbonyl-4-methylpentanoyl]amino]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[2-(2,3-dihydrothiophen-2-yl)-1,3-thiazol-4-yl]-2-[[(2S)-2-methoxycarbonyl-4-methylpentanoyl]amino]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 71101240 |
| Molecular Formula | C23H29N3O6S3 |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | [4-[(2S)-2-[2-(2,3-dihydrothiophen-2-yl)-1,3-thiazol-4-yl]-2-[[(2S)-2-methoxycarbonyl-4-methylpentanoyl]amino]ethyl]phenyl]sulfamic acid |
| SMILES | COC(=O)[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)c1csc(C2CC=CS2)n1 |
| InChI | InChI=1S/C23H29N3O6S3/c1-14(2)11-17(23(28)32-3)21(27)24-18(19-13-34-22(25-19)20-5-4-10-33-20)12-15-6-8-16(9-7-15)26-35(29,30)31/h4,6-10,13-14,17-18,20,26H,5,11-12H2,1-3H3,(H,24,27)(H,29,30,31)/t17-,18-,20?/m0/s1 |
| InChIKey | VXKMKNFLISRHJF-IJXZTRCJSA-N |
| XLogP | 4.28 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|