C24H26F3N3O6S2 — CID 71101265
[4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-[4-(2,2,2-trifluoroethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethyl]phenyl]sulfamic acid (PubChem CID 71101265) has the molecular formula C24H26F3N3O6S2 and a molecular weight of 573.62 g/mol. Its IUPAC name is [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-[4-(2,2,2-trifluoroethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-[4-(2,2,2-trifluoroethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 71101265 |
| Molecular Formula | C24H26F3N3O6S2 |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | [4-[(2S)-2-[[(2S)-2-benzyl-3-methoxy-3-oxopropanoyl]amino]-2-[4-(2,2,2-trifluoroethyl)-4,5-dihydro-1,3-thiazol-2-yl]ethyl]phenyl]sulfamic acid |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(NS(=O)(=O)O)cc1)C1=NC(CC(F)(F)F)CS1 |
| InChI | InChI=1S/C24H26F3N3O6S2/c1-36-23(32)19(11-15-5-3-2-4-6-15)21(31)29-20(22-28-18(14-37-22)13-24(25,26)27)12-16-7-9-17(10-8-16)30-38(33,34)35/h2-10,18-20,30H,11-14H2,1H3,(H,29,31)(H,33,34,35)/t18?,19-,20-/m0/s1 |
| InChIKey | GYPXMVXLRLQOHB-YPJRHXLCSA-N |
| XLogP | 3.43 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|