C31H32N4O5S — CID 76653712
tert-butyl N-[1-[[2-(4-nitrophenyl)-1-(2-phenyl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 76653712) has the molecular formula C31H32N4O5S and a molecular weight of 572.69 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-(4-nitrophenyl)-1-(2-phenyl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-(4-nitrophenyl)-1-(2-phenyl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 76653712 |
| Molecular Formula | C31H32N4O5S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | tert-butyl N-[1-[[2-(4-nitrophenyl)-1-(2-phenyl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccc([N+](=O)[O-])cc1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C31H32N4O5S/c1-31(2,3)40-30(37)34-26(19-21-10-6-4-7-11-21)28(36)32-25(18-22-14-16-24(17-15-22)35(38)39)27-20-41-29(33-27)23-12-8-5-9-13-23/h4-17,20,25-26H,18-19H2,1-3H3,(H,32,36)(H,34,37) |
| InChIKey | NALGMQLTLWNWEN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|