C27H26N4O5S2 — CID 163570960
methyl 2-[[1-[[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]acetate (PubChem CID 163570960) has the molecular formula C27H26N4O5S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is methyl 2-[[1-[[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]acetate.
| Compound Name | methyl 2-[[1-[[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 163570960 |
| Molecular Formula | C27H26N4O5S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | methyl 2-[[1-[[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-phenylpropan-2-yl]amino]acetate |
| SMILES | COC(=O)CNC(Cc1ccccc1)C(=O)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C27H26N4O5S2/c1-36-25(32)16-28-22(15-18-6-3-2-4-7-18)26(33)29-21(14-19-9-11-20(12-10-19)31(34)35)23-17-38-27(30-23)24-8-5-13-37-24/h2-13,17,21-22,28H,14-16H2,1H3,(H,29,33)/t21-,22?/m0/s1 |
| InChIKey | FZHNZFMASNSSFV-HMTLIYDFSA-N |
| XLogP | 4.55 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|