C31H28BrN7O4S5 — CID 159207662
(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethanamine;[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]thiourea;hydrobromide (PubChem CID 159207662) has the molecular formula C31H28BrN7O4S5 and a molecular weight of 802.85 g/mol. Its IUPAC name is (1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethanamine;[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]thiourea;hydrobromide.
| Compound Name | (1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethanamine;[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]thiourea;hydrobromide |
|---|---|
| PubChem CID | 159207662 |
| Molecular Formula | C31H28BrN7O4S5 |
| Molecular Weight | 802.85 g/mol |
| Exact Mass | 801.00 |
| IUPAC Name | (1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethanamine;[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]thiourea;hydrobromide |
| SMILES | Br.NC(=S)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)c1csc(-c2cccs2)n1.N[C@@H](Cc1ccc([N+](=O)[O-])cc1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C16H14N4O2S3.C15H13N3O2S2.BrH/c17-16(23)19-12(8-10-3-5-11(6-4-10)20(21)22)13-9-25-15(18-13)14-2-1-7-24-14;16-12(8-10-3-5-11(6-4-10)18(19)20)13-9-22-15(17-13)14-2-1-7-21-14;/h1-7,9,12H,8H2,(H3,17,19,23);1-7,9,12H,8,16H2;1H/t2*12-;/m00./s1 |
| InChIKey | BKAWEBZBQQNNAV-NMFAMCKASA-N |
| XLogP | 8.50 |
| TPSA | 176.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.85 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|