C15H14BrN3O2S2 — CID 175528662
2-(4-nitrophenyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethanamine;hydrobromide (PubChem CID 175528662) has the molecular formula C15H14BrN3O2S2 and a molecular weight of 412.33 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethanamine;hydrobromide.
| Compound Name | 2-(4-nitrophenyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethanamine;hydrobromide |
|---|---|
| PubChem CID | 175528662 |
| Molecular Formula | C15H14BrN3O2S2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 2-(4-nitrophenyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)ethanamine;hydrobromide |
| SMILES | Br.NC(Cc1ccc([N+](=O)[O-])cc1)c1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C15H13N3O2S2.BrH/c16-12(8-10-3-5-11(6-4-10)18(19)20)15-17-13(9-22-15)14-2-1-7-21-14;/h1-7,9,12H,8,16H2;1H |
| InChIKey | KPLMEFXAOXEWOD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|