C14H16BrN3O2S — CID 118646046
(1S)-1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethanamine;hydrobromide (PubChem CID 118646046) has the molecular formula C14H16BrN3O2S and a molecular weight of 370.27 g/mol. Its IUPAC name is (1S)-1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethanamine;hydrobromide.
| Compound Name | (1S)-1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethanamine;hydrobromide |
|---|---|
| PubChem CID | 118646046 |
| Molecular Formula | C14H16BrN3O2S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | (1S)-1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethanamine;hydrobromide |
| SMILES | Br.N[C@@H](Cc1ccc([N+](=O)[O-])cc1)c1csc(C2CC2)n1 |
| InChI | InChI=1S/C14H15N3O2S.BrH/c15-12(13-8-20-14(16-13)10-3-4-10)7-9-1-5-11(6-2-9)17(18)19;/h1-2,5-6,8,10,12H,3-4,7,15H2;1H/t12-;/m0./s1 |
| InChIKey | CZGICVVORNLLCZ-YDALLXLXSA-N |
| XLogP | 3.75 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|