C25H24N4O3S2 — CID 87118398
N-[1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethyl]-4-[(3-methoxyphenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 87118398) has the molecular formula C25H24N4O3S2 and a molecular weight of 492.63 g/mol. Its IUPAC name is N-[1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethyl]-4-[(3-methoxyphenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethyl]-4-[(3-methoxyphenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87118398 |
| Molecular Formula | C25H24N4O3S2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | N-[1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-(4-nitrophenyl)ethyl]-4-[(3-methoxyphenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | COc1cccc(Cc2csc(NC(Cc3ccc([N+](=O)[O-])cc3)c3csc(C4CC4)n3)n2)c1 |
| InChI | InChI=1S/C25H24N4O3S2/c1-32-21-4-2-3-17(12-21)11-19-14-34-25(26-19)28-22(23-15-33-24(27-23)18-7-8-18)13-16-5-9-20(10-6-16)29(30)31/h2-6,9-10,12,14-15,18,22H,7-8,11,13H2,1H3,(H,26,28) |
| InChIKey | NGDQPHPYBDYZNQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|