C14H19N3O2S — CID 143601529
ethane;(1S)-1-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)ethanamine (PubChem CID 143601529) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is ethane;(1S)-1-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)ethanamine.
| Compound Name | ethane;(1S)-1-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 143601529 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethane;(1S)-1-(4-methyl-1,3-thiazol-2-yl)-2-(4-nitrophenyl)ethanamine |
| SMILES | CC.Cc1csc([C@@H](N)Cc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C12H13N3O2S.C2H6/c1-8-7-18-12(14-8)11(13)6-9-2-4-10(5-3-9)15(16)17;1-2/h2-5,7,11H,6,13H2,1H3;1-2H3/t11-;/m0./s1 |
| InChIKey | JUQRJNPECOGIQQ-MERQFXBCSA-N |
| XLogP | 3.63 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|