C24H21N5O5S2 — CID 175528630
[(2S)-1-[[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-pyridin-4-ylpropan-2-yl] carbamate (PubChem CID 175528630) has the molecular formula C24H21N5O5S2 and a molecular weight of 523.60 g/mol. Its IUPAC name is [(2S)-1-[[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-pyridin-4-ylpropan-2-yl] carbamate.
| Compound Name | [(2S)-1-[[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-pyridin-4-ylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175528630 |
| Molecular Formula | C24H21N5O5S2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | [(2S)-1-[[(1S)-2-(4-nitrophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-1-oxo-3-pyridin-4-ylpropan-2-yl] carbamate |
| SMILES | NC(=O)O[C@@H](Cc1ccncc1)C(=O)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C24H21N5O5S2/c25-24(31)34-20(13-16-7-9-26-10-8-16)22(30)27-18(12-15-3-5-17(6-4-15)29(32)33)19-14-36-23(28-19)21-2-1-11-35-21/h1-11,14,18,20H,12-13H2,(H2,25,31)(H,27,30)/t18-,20-/m0/s1 |
| InChIKey | YLRVPOGXAHNFDH-ICSRJNTNSA-N |
| XLogP | 4.28 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|