C26H35N5O3S2 — CID 169081595
methyl N-[1-[[(1S)-2-(4-aminophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-6-(dimethylamino)-1-oxohexan-2-yl]-N-methylcarbamate (PubChem CID 169081595) has the molecular formula C26H35N5O3S2 and a molecular weight of 529.73 g/mol. Its IUPAC name is methyl N-[1-[[(1S)-2-(4-aminophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-6-(dimethylamino)-1-oxohexan-2-yl]-N-methylcarbamate.
| Compound Name | methyl N-[1-[[(1S)-2-(4-aminophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-6-(dimethylamino)-1-oxohexan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 169081595 |
| Molecular Formula | C26H35N5O3S2 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | methyl N-[1-[[(1S)-2-(4-aminophenyl)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]amino]-6-(dimethylamino)-1-oxohexan-2-yl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)C(CCCCN(C)C)C(=O)N[C@@H](Cc1ccc(N)cc1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C26H35N5O3S2/c1-30(2)14-6-5-8-22(31(3)26(33)34-4)24(32)28-20(16-18-10-12-19(27)13-11-18)21-17-36-25(29-21)23-9-7-15-35-23/h7,9-13,15,17,20,22H,5-6,8,14,16,27H2,1-4H3,(H,28,32)/t20-,22?/m0/s1 |
| InChIKey | RTUZMWLTRXDPIB-AIBWNMTMSA-N |
| XLogP | 4.65 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|