C22H22N4O3S2 — CID 134426485
5-(2-methylphenyl)-2-[[(1S)-1-(2-methyl-1,3-thiazol-4-yl)-2-[4-(sulfinoamino)phenyl]ethyl]amino]-1,3-oxazole (PubChem CID 134426485) has the molecular formula C22H22N4O3S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is 5-(2-methylphenyl)-2-[[(1S)-1-(2-methyl-1,3-thiazol-4-yl)-2-[4-(sulfinoamino)phenyl]ethyl]amino]-1,3-oxazole.
| Compound Name | 5-(2-methylphenyl)-2-[[(1S)-1-(2-methyl-1,3-thiazol-4-yl)-2-[4-(sulfinoamino)phenyl]ethyl]amino]-1,3-oxazole |
|---|---|
| PubChem CID | 134426485 |
| Molecular Formula | C22H22N4O3S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 5-(2-methylphenyl)-2-[[(1S)-1-(2-methyl-1,3-thiazol-4-yl)-2-[4-(sulfinoamino)phenyl]ethyl]amino]-1,3-oxazole |
| SMILES | Cc1nc([C@H](Cc2ccc(NS(=O)O)cc2)Nc2ncc(-c3ccccc3C)o2)cs1 |
| InChI | InChI=1S/C22H22N4O3S2/c1-14-5-3-4-6-18(14)21-12-23-22(29-21)25-19(20-13-30-15(2)24-20)11-16-7-9-17(10-8-16)26-31(27)28/h3-10,12-13,19,26H,11H2,1-2H3,(H,23,25)(H,27,28)/t19-/m0/s1 |
| InChIKey | MLKJMTZZNIOZAA-IBGZPJMESA-N |
| XLogP | 5.36 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|