C28H32N4O4S2 — CID 134426509
tert-butyl (2S)-2-[2-[[(1S)-2-[4-(hydroxysulfanylamino)phenyl]-1-(2-methyl-1,3-thiazol-4-yl)ethyl]amino]-1,3-oxazol-5-yl]-3-phenylpropanoate (PubChem CID 134426509) has the molecular formula C28H32N4O4S2 and a molecular weight of 552.72 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-[[(1S)-2-[4-(hydroxysulfanylamino)phenyl]-1-(2-methyl-1,3-thiazol-4-yl)ethyl]amino]-1,3-oxazol-5-yl]-3-phenylpropanoate.
| Compound Name | tert-butyl (2S)-2-[2-[[(1S)-2-[4-(hydroxysulfanylamino)phenyl]-1-(2-methyl-1,3-thiazol-4-yl)ethyl]amino]-1,3-oxazol-5-yl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 134426509 |
| Molecular Formula | C28H32N4O4S2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | tert-butyl (2S)-2-[2-[[(1S)-2-[4-(hydroxysulfanylamino)phenyl]-1-(2-methyl-1,3-thiazol-4-yl)ethyl]amino]-1,3-oxazol-5-yl]-3-phenylpropanoate |
| SMILES | Cc1nc([C@H](Cc2ccc(NSO)cc2)Nc2ncc([C@H](Cc3ccccc3)C(=O)OC(C)(C)C)o2)cs1 |
| InChI | InChI=1S/C28H32N4O4S2/c1-18-30-24(17-37-18)23(15-20-10-12-21(13-11-20)32-38-34)31-27-29-16-25(35-27)22(26(33)36-28(2,3)4)14-19-8-6-5-7-9-19/h5-13,16-17,22-23,32,34H,14-15H2,1-4H3,(H,29,31)/t22-,23-/m0/s1 |
| InChIKey | RSRDYGVGEKKNPR-GOTSBHOMSA-N |
| XLogP | 7.04 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|