C21H19N4O4S4- — CID 154970856
4-[(1S)-1-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-2-thiophen-2-yl-1,3-thiazole (PubChem CID 154970856) has the molecular formula C21H19N4O4S4- and a molecular weight of 519.68 g/mol. Its IUPAC name is 4-[(1S)-1-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-2-thiophen-2-yl-1,3-thiazole.
| Compound Name | 4-[(1S)-1-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-2-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 154970856 |
| Molecular Formula | C21H19N4O4S4- |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | 4-[(1S)-1-[(4-ethoxycarbonyl-1,3-thiazol-2-yl)amino]-2-[4-(sulfinatoamino)phenyl]ethyl]-2-thiophen-2-yl-1,3-thiazole |
| SMILES | CCOC(=O)c1csc(N[C@@H](Cc2ccc(NS(=O)[O-])cc2)c2csc(-c3cccs3)n2)n1 |
| InChI | InChI=1S/C21H20N4O4S4/c1-2-29-20(26)17-12-32-21(24-17)23-15(10-13-5-7-14(8-6-13)25-33(27)28)16-11-31-19(22-16)18-4-3-9-30-18/h3-9,11-12,15,25H,2,10H2,1H3,(H,23,24)(H,27,28)/p-1/t15-/m0/s1 |
| InChIKey | XDKFRNBULUJTBB-HNNXBMFYSA-M |
| XLogP | 5.11 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|