C23H20ClN3O4S3 — CID 66695073
[4-[2-[[2-(3-chlorophenyl)acetyl]amino]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid (PubChem CID 66695073) has the molecular formula C23H20ClN3O4S3 and a molecular weight of 534.08 g/mol. Its IUPAC name is [4-[2-[[2-(3-chlorophenyl)acetyl]amino]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-[[2-(3-chlorophenyl)acetyl]amino]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 66695073 |
| Molecular Formula | C23H20ClN3O4S3 |
| Molecular Weight | 534.08 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | [4-[2-[[2-(3-chlorophenyl)acetyl]amino]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
| SMILES | O=C(Cc1cccc(Cl)c1)NC(Cc1ccc(NS(=O)(=O)O)cc1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C23H20ClN3O4S3/c24-17-4-1-3-16(11-17)13-22(28)25-19(20-14-33-23(26-20)21-5-2-10-32-21)12-15-6-8-18(9-7-15)27-34(29,30)31/h1-11,14,19,27H,12-13H2,(H,25,28)(H,29,30,31) |
| InChIKey | JTOKCZNREAOLEP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.08 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|