C27H22ClN4O6S5- — CID 71225476
4-[1-[[5-[[(4-chlorobenzoyl)amino]methyl]thiophen-2-yl]-sulfinatoamino]-2-[4-(sulfoamino)phenyl]ethyl]-2-thiophen-2-yl-1,3-thiazole (PubChem CID 71225476) has the molecular formula C27H22ClN4O6S5- and a molecular weight of 694.28 g/mol. Its IUPAC name is 4-[1-[[5-[[(4-chlorobenzoyl)amino]methyl]thiophen-2-yl]-sulfinatoamino]-2-[4-(sulfoamino)phenyl]ethyl]-2-thiophen-2-yl-1,3-thiazole.
| Compound Name | 4-[1-[[5-[[(4-chlorobenzoyl)amino]methyl]thiophen-2-yl]-sulfinatoamino]-2-[4-(sulfoamino)phenyl]ethyl]-2-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 71225476 |
| Molecular Formula | C27H22ClN4O6S5- |
| Molecular Weight | 694.28 g/mol |
| Exact Mass | 692.98 |
| IUPAC Name | 4-[1-[[5-[[(4-chlorobenzoyl)amino]methyl]thiophen-2-yl]-sulfinatoamino]-2-[4-(sulfoamino)phenyl]ethyl]-2-thiophen-2-yl-1,3-thiazole |
| SMILES | O=C(NCc1ccc(N(C(Cc2ccc(NS(=O)(=O)O)cc2)c2csc(-c3cccs3)n2)S(=O)[O-])s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H23ClN4O6S5/c28-19-7-5-18(6-8-19)26(33)29-15-21-11-12-25(41-21)32(42(34)35)23(22-16-40-27(30-22)24-2-1-13-39-24)14-17-3-9-20(10-4-17)31-43(36,37)38/h1-13,16,23,31H,14-15H2,(H,29,33)(H,34,35)(H,36,37,38)/p-1 |
| InChIKey | ZRSFTJHXAQUGEL-UHFFFAOYSA-M |
| XLogP | 6.32 |
| TPSA | 151.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.28 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|