C22H21N3O4S3 — CID 175296273
[4-[2-(phenylmethoxyamino)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid (PubChem CID 175296273) has the molecular formula C22H21N3O4S3 and a molecular weight of 487.63 g/mol. Its IUPAC name is [4-[2-(phenylmethoxyamino)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-(phenylmethoxyamino)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 175296273 |
| Molecular Formula | C22H21N3O4S3 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | [4-[2-(phenylmethoxyamino)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
| SMILES | O=S(=O)(O)Nc1ccc(CC(NOCc2ccccc2)c2csc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C22H21N3O4S3/c26-32(27,28)25-18-10-8-16(9-11-18)13-19(24-29-14-17-5-2-1-3-6-17)20-15-31-22(23-20)21-7-4-12-30-21/h1-12,15,19,24-25H,13-14H2,(H,26,27,28) |
| InChIKey | ZSYXGJHUGFETAX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|