C20H19IN4O3S3 — CID 152946099
[4-[(2S)-2-[(4-methyl-1λ3-ioda-2-thia-5-azacyclopenta-3,5-dien-3-yl)amino]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid (PubChem CID 152946099) has the molecular formula C20H19IN4O3S3 and a molecular weight of 586.50 g/mol. Its IUPAC name is [4-[(2S)-2-[(4-methyl-1λ3-ioda-2-thia-5-azacyclopenta-3,5-dien-3-yl)amino]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(2S)-2-[(4-methyl-1λ3-ioda-2-thia-5-azacyclopenta-3,5-dien-3-yl)amino]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 152946099 |
| Molecular Formula | C20H19IN4O3S3 |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 585.97 |
| IUPAC Name | [4-[(2S)-2-[(4-methyl-1λ3-ioda-2-thia-5-azacyclopenta-3,5-dien-3-yl)amino]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
| SMILES | CC1=C(N[C@@H](Cc2ccc(NS(=O)(=O)O)cc2)c2csc(-c3ccccc3)n2)SI=N1 |
| InChI | InChI=1S/C20H19IN4O3S3/c1-13-19(30-21-24-13)22-17(11-14-7-9-16(10-8-14)25-31(26,27)28)18-12-29-20(23-18)15-5-3-2-4-6-15/h2-10,12,17,22,25H,11H2,1H3,(H,26,27,28)/t17-/m0/s1 |
| InChIKey | UNTZYPXYUXUNLK-KRWDZBQOSA-N |
| XLogP | 5.90 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|