C20H19AsN4O3S3 — CID 173122790
[4-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)arsanyl]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid (PubChem CID 173122790) has the molecular formula C20H19AsN4O3S3 and a molecular weight of 534.52 g/mol. Its IUPAC name is [4-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)arsanyl]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)arsanyl]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 173122790 |
| Molecular Formula | C20H19AsN4O3S3 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 533.98 |
| IUPAC Name | [4-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)arsanyl]-2-(2-phenyl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
| SMILES | Cc1nnc([AsH]C(Cc2ccc(NS(=O)(=O)O)cc2)c2csc(-c3ccccc3)n2)s1 |
| InChI | InChI=1S/C20H19AsN4O3S3/c1-13-23-24-20(30-13)21-17(11-14-7-9-16(10-8-14)25-31(26,27)28)18-12-29-19(22-18)15-5-3-2-4-6-15/h2-10,12,17,21,25H,11H2,1H3,(H,26,27,28) |
| InChIKey | AJCLLMOFYOTVDI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|