C24H24N4O3S3 — CID 130369925
4-[(2R)-1-(benzylcarbamoylamino)-3-[4-(sulfinoamino)phenyl]propan-2-yl]-2-thiophen-2-yl-1,3-thiazole (PubChem CID 130369925) has the molecular formula C24H24N4O3S3 and a molecular weight of 512.68 g/mol. Its IUPAC name is 4-[(2R)-1-(benzylcarbamoylamino)-3-[4-(sulfinoamino)phenyl]propan-2-yl]-2-thiophen-2-yl-1,3-thiazole.
| Compound Name | 4-[(2R)-1-(benzylcarbamoylamino)-3-[4-(sulfinoamino)phenyl]propan-2-yl]-2-thiophen-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 130369925 |
| Molecular Formula | C24H24N4O3S3 |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | 4-[(2R)-1-(benzylcarbamoylamino)-3-[4-(sulfinoamino)phenyl]propan-2-yl]-2-thiophen-2-yl-1,3-thiazole |
| SMILES | O=C(NCc1ccccc1)NC[C@@H](Cc1ccc(NS(=O)O)cc1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C24H24N4O3S3/c29-24(25-14-18-5-2-1-3-6-18)26-15-19(13-17-8-10-20(11-9-17)28-34(30)31)21-16-33-23(27-21)22-7-4-12-32-22/h1-12,16,19,28H,13-15H2,(H,30,31)(H2,25,26,29)/t19-/m1/s1 |
| InChIKey | YTLACOHTNQRHDJ-LJQANCHMSA-N |
| XLogP | 5.25 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|