C19H20N2O2S2 — CID 120512015
5-phenyl-4-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]pentanoic acid (PubChem CID 120512015) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 5-phenyl-4-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]pentanoic acid.
| Compound Name | 5-phenyl-4-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]pentanoic acid |
|---|---|
| PubChem CID | 120512015 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 5-phenyl-4-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylamino]pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NCc1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C19H20N2O2S2/c22-18(23)9-8-15(11-14-5-2-1-3-6-14)20-12-16-13-25-19(21-16)17-7-4-10-24-17/h1-7,10,13,15,20H,8-9,11-12H2,(H,22,23) |
| InChIKey | MKQKRBOJSYABQP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |