C17H16N2O3S3 — CID 161018253
[4-[[1-(2-thiophen-2-yl-1,3-thiazol-4-yl)cyclopropyl]methyl]phenyl]sulfamic acid (PubChem CID 161018253) has the molecular formula C17H16N2O3S3 and a molecular weight of 392.53 g/mol. Its IUPAC name is [4-[[1-(2-thiophen-2-yl-1,3-thiazol-4-yl)cyclopropyl]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[1-(2-thiophen-2-yl-1,3-thiazol-4-yl)cyclopropyl]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 161018253 |
| Molecular Formula | C17H16N2O3S3 |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | [4-[[1-(2-thiophen-2-yl-1,3-thiazol-4-yl)cyclopropyl]methyl]phenyl]sulfamic acid |
| SMILES | O=S(=O)(O)Nc1ccc(CC2(c3csc(-c4cccs4)n3)CC2)cc1 |
| InChI | InChI=1S/C17H16N2O3S3/c20-25(21,22)19-13-5-3-12(4-6-13)10-17(7-8-17)15-11-24-16(18-15)14-2-1-9-23-14/h1-6,9,11,19H,7-8,10H2,(H,20,21,22) |
| InChIKey | TXZZTEAMSTXFGA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|