C24H23N3O5S3 — CID 175296286
[4-[(1S)-1-(N-acetyl-3-methoxyanilino)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid (PubChem CID 175296286) has the molecular formula C24H23N3O5S3 and a molecular weight of 529.67 g/mol. Its IUPAC name is [4-[(1S)-1-(N-acetyl-3-methoxyanilino)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid.
| Compound Name | [4-[(1S)-1-(N-acetyl-3-methoxyanilino)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 175296286 |
| Molecular Formula | C24H23N3O5S3 |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | [4-[(1S)-1-(N-acetyl-3-methoxyanilino)-1-(2-thiophen-2-yl-1,3-thiazol-4-yl)ethyl]phenyl]sulfamic acid |
| SMILES | COc1cccc(N(C(C)=O)[C@@](C)(c2ccc(NS(=O)(=O)O)cc2)c2csc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C24H23N3O5S3/c1-16(28)27(19-6-4-7-20(14-19)32-3)24(2,17-9-11-18(12-10-17)26-35(29,30)31)22-15-34-23(25-22)21-8-5-13-33-21/h4-15,26H,1-3H3,(H,29,30,31)/t24-/m0/s1 |
| InChIKey | XBLXLYVJIKQCOM-DEOSSOPVSA-N |
| XLogP | 5.41 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|