C21H19N3O6S4 — CID 171348267
[4-[[(3-methoxyphenyl)sulfonyl-(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]methyl]phenyl]sulfamic acid (PubChem CID 171348267) has the molecular formula C21H19N3O6S4 and a molecular weight of 537.67 g/mol. Its IUPAC name is [4-[[(3-methoxyphenyl)sulfonyl-(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]methyl]phenyl]sulfamic acid.
| Compound Name | [4-[[(3-methoxyphenyl)sulfonyl-(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 171348267 |
| Molecular Formula | C21H19N3O6S4 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.02 |
| IUPAC Name | [4-[[(3-methoxyphenyl)sulfonyl-(4-thiophen-2-yl-1,3-thiazol-2-yl)amino]methyl]phenyl]sulfamic acid |
| SMILES | COc1cccc(S(=O)(=O)N(Cc2ccc(NS(=O)(=O)O)cc2)c2nc(-c3cccs3)cs2)c1 |
| InChI | InChI=1S/C21H19N3O6S4/c1-30-17-4-2-5-18(12-17)33(25,26)24(21-22-19(14-32-21)20-6-3-11-31-20)13-15-7-9-16(10-8-15)23-34(27,28)29/h2-12,14,23H,13H2,1H3,(H,27,28,29) |
| InChIKey | YCQAYYKPDURFRM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|