C16H19N7O4S2 — CID 143725060
[4-[[amino-(2,5-diamino-6-thiophen-2-ylpyrimidin-4-yl)amino]methyl]-2-methoxyphenyl]sulfamic acid (PubChem CID 143725060) has the molecular formula C16H19N7O4S2 and a molecular weight of 437.51 g/mol. Its IUPAC name is [4-[[amino-(2,5-diamino-6-thiophen-2-ylpyrimidin-4-yl)amino]methyl]-2-methoxyphenyl]sulfamic acid.
| Compound Name | [4-[[amino-(2,5-diamino-6-thiophen-2-ylpyrimidin-4-yl)amino]methyl]-2-methoxyphenyl]sulfamic acid |
|---|---|
| PubChem CID | 143725060 |
| Molecular Formula | C16H19N7O4S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | [4-[[amino-(2,5-diamino-6-thiophen-2-ylpyrimidin-4-yl)amino]methyl]-2-methoxyphenyl]sulfamic acid |
| SMILES | COc1cc(CN(N)c2nc(N)nc(-c3cccs3)c2N)ccc1NS(=O)(=O)O |
| InChI | InChI=1S/C16H19N7O4S2/c1-27-11-7-9(4-5-10(11)22-29(24,25)26)8-23(19)15-13(17)14(20-16(18)21-15)12-3-2-6-28-12/h2-7,22H,8,17,19H2,1H3,(H2,18,20,21)(H,24,25,26) |
| InChIKey | RPMTVNMRUPTTDA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 182.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|