C17H19N5O5S2 — CID 176729683
ethyl 2-[[(5-methoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-sulfamoylamino]acetate (PubChem CID 176729683) has the molecular formula C17H19N5O5S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is ethyl 2-[[(5-methoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-sulfamoylamino]acetate.
| Compound Name | ethyl 2-[[(5-methoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-sulfamoylamino]acetate |
|---|---|
| PubChem CID | 176729683 |
| Molecular Formula | C17H19N5O5S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | ethyl 2-[[(5-methoxy-2-thiophen-2-ylquinazolin-4-yl)amino]-sulfamoylamino]acetate |
| SMILES | CCOC(=O)CN(Nc1nc(-c2cccs2)nc2cccc(OC)c12)S(N)(=O)=O |
| InChI | InChI=1S/C17H19N5O5S2/c1-3-27-14(23)10-22(29(18,24)25)21-17-15-11(6-4-7-12(15)26-2)19-16(20-17)13-8-5-9-28-13/h4-9H,3,10H2,1-2H3,(H2,18,24,25)(H,19,20,21) |
| InChIKey | OHEYXNRDEIQQON-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|