C19H18N4O3S — CID 22124930
(Z)-N-(5-methoxy-2-thiophen-2-ylquinazolin-4-yl)-N',2-dimethyl-4-oxobut-2-enehydrazide (PubChem CID 22124930) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is (Z)-N-(5-methoxy-2-thiophen-2-ylquinazolin-4-yl)-N',2-dimethyl-4-oxobut-2-enehydrazide.
| Compound Name | (Z)-N-(5-methoxy-2-thiophen-2-ylquinazolin-4-yl)-N',2-dimethyl-4-oxobut-2-enehydrazide |
|---|---|
| PubChem CID | 22124930 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (Z)-N-(5-methoxy-2-thiophen-2-ylquinazolin-4-yl)-N',2-dimethyl-4-oxobut-2-enehydrazide |
| SMILES | CNN(C(=O)/C(C)=C\C=O)c1nc(-c2cccs2)nc2cccc(OC)c12 |
| InChI | InChI=1S/C19H18N4O3S/c1-12(9-10-24)19(25)23(20-2)18-16-13(6-4-7-14(16)26-3)21-17(22-18)15-8-5-11-27-15/h4-11,20H,1-3H3/b12-9- |
| InChIKey | XCJMEEFQADRPLA-XFXZXTDPSA-N |
| XLogP | 2.98 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|