C19H23N7O5S — CID 143725069
[4-[[amino-[2,5-diamino-6-(2-methoxyphenyl)pyrimidin-4-yl]amino]methyl]-2-methoxyphenyl]sulfamic acid (PubChem CID 143725069) has the molecular formula C19H23N7O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is [4-[[amino-[2,5-diamino-6-(2-methoxyphenyl)pyrimidin-4-yl]amino]methyl]-2-methoxyphenyl]sulfamic acid.
| Compound Name | [4-[[amino-[2,5-diamino-6-(2-methoxyphenyl)pyrimidin-4-yl]amino]methyl]-2-methoxyphenyl]sulfamic acid |
|---|---|
| PubChem CID | 143725069 |
| Molecular Formula | C19H23N7O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [4-[[amino-[2,5-diamino-6-(2-methoxyphenyl)pyrimidin-4-yl]amino]methyl]-2-methoxyphenyl]sulfamic acid |
| SMILES | COc1cc(CN(N)c2nc(N)nc(-c3ccccc3OC)c2N)ccc1NS(=O)(=O)O |
| InChI | InChI=1S/C19H23N7O5S/c1-30-14-6-4-3-5-12(14)17-16(20)18(24-19(21)23-17)26(22)10-11-7-8-13(15(9-11)31-2)25-32(27,28)29/h3-9,25H,10,20,22H2,1-2H3,(H2,21,23,24)(H,27,28,29) |
| InChIKey | WPOBHIQQHJWOHF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 191.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|