C18H21N7O3S — CID 143725066
[4-[[amino-(2,5-diamino-6-phenylpyrimidin-4-yl)amino]methyl]-2-methylphenyl]sulfamic acid (PubChem CID 143725066) has the molecular formula C18H21N7O3S and a molecular weight of 415.48 g/mol. Its IUPAC name is [4-[[amino-(2,5-diamino-6-phenylpyrimidin-4-yl)amino]methyl]-2-methylphenyl]sulfamic acid.
| Compound Name | [4-[[amino-(2,5-diamino-6-phenylpyrimidin-4-yl)amino]methyl]-2-methylphenyl]sulfamic acid |
|---|---|
| PubChem CID | 143725066 |
| Molecular Formula | C18H21N7O3S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [4-[[amino-(2,5-diamino-6-phenylpyrimidin-4-yl)amino]methyl]-2-methylphenyl]sulfamic acid |
| SMILES | Cc1cc(CN(N)c2nc(N)nc(-c3ccccc3)c2N)ccc1NS(=O)(=O)O |
| InChI | InChI=1S/C18H21N7O3S/c1-11-9-12(7-8-14(11)24-29(26,27)28)10-25(21)17-15(19)16(22-18(20)23-17)13-5-3-2-4-6-13/h2-9,24H,10,19,21H2,1H3,(H2,20,22,23)(H,26,27,28) |
| InChIKey | HXADGGOKRZVWBN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 173.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|