C17H18N2O7S — CID 15289705
5-amino-3,4-bis(ethoxycarbonyl)-6-phenylpyridine-2-sulfonic acid (PubChem CID 15289705) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is 5-amino-3,4-bis(ethoxycarbonyl)-6-phenylpyridine-2-sulfonic acid.
| Compound Name | 5-amino-3,4-bis(ethoxycarbonyl)-6-phenylpyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 15289705 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 5-amino-3,4-bis(ethoxycarbonyl)-6-phenylpyridine-2-sulfonic acid |
| SMILES | CCOC(=O)c1c(S(=O)(=O)O)nc(-c2ccccc2)c(N)c1C(=O)OCC |
| InChI | InChI=1S/C17H18N2O7S/c1-3-25-16(20)11-12(17(21)26-4-2)15(27(22,23)24)19-14(13(11)18)10-8-6-5-7-9-10/h5-9H,3-4,18H2,1-2H3,(H,22,23,24) |
| InChIKey | MPDPTHLBTOBASB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|