C11H10NO4S3- — CID 69414729
(4-ethoxycarbonyl-1,3-thiazol-2-yl)-thiophen-2-ylmethanesulfinate (PubChem CID 69414729) has the molecular formula C11H10NO4S3- and a molecular weight of 316.41 g/mol. Its IUPAC name is (4-ethoxycarbonyl-1,3-thiazol-2-yl)-thiophen-2-ylmethanesulfinate.
| Compound Name | (4-ethoxycarbonyl-1,3-thiazol-2-yl)-thiophen-2-ylmethanesulfinate |
|---|---|
| PubChem CID | 69414729 |
| Molecular Formula | C11H10NO4S3- |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | (4-ethoxycarbonyl-1,3-thiazol-2-yl)-thiophen-2-ylmethanesulfinate |
| SMILES | CCOC(=O)c1csc(C(c2cccs2)S(=O)[O-])n1 |
| InChI | InChI=1S/C11H11NO4S3/c1-2-16-11(13)7-6-18-10(12-7)9(19(14)15)8-4-3-5-17-8/h3-6,9H,2H2,1H3,(H,14,15)/p-1 |
| InChIKey | YFRNKXYIZMGMII-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 79.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|