C12H9N3O2 — CID 113242136
6-(6-amino-1,3-benzoxazol-2-yl)-1H-pyridin-2-one (PubChem CID 113242136) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 6-(6-amino-1,3-benzoxazol-2-yl)-1H-pyridin-2-one.
| Compound Name | 6-(6-amino-1,3-benzoxazol-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 113242136 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 6-(6-amino-1,3-benzoxazol-2-yl)-1H-pyridin-2-one |
| SMILES | Nc1ccc2nc(-c3cccc(=O)[nH]3)oc2c1 |
| InChI | InChI=1S/C12H9N3O2/c13-7-4-5-8-10(6-7)17-12(15-8)9-2-1-3-11(16)14-9/h1-6H,13H2,(H,14,16) |
| InChIKey | PLMOBAGLGAXGCC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|