C18H13F3N4O3S — CID 6734599
N-(quinolin-4-ylmethylideneamino)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetamide (PubChem CID 6734599) has the molecular formula C18H13F3N4O3S and a molecular weight of 422.39 g/mol. Its IUPAC name is N-(quinolin-4-ylmethylideneamino)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetamide.
| Compound Name | N-(quinolin-4-ylmethylideneamino)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetamide |
|---|---|
| PubChem CID | 6734599 |
| Molecular Formula | C18H13F3N4O3S |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-(quinolin-4-ylmethylideneamino)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]acetamide |
| SMILES | O=C(CS(=O)(=O)c1ccc(C(F)(F)F)cn1)NN=Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C18H13F3N4O3S/c19-18(20,21)13-5-6-17(23-10-13)29(27,28)11-16(26)25-24-9-12-7-8-22-15-4-2-1-3-14(12)15/h1-10H,11H2,(H,25,26) |
| InChIKey | YPRQTXNGBQZKDX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|