C17H12BrF3N4O4 — CID 3975181
N'-[(4-bromo-3-nitrophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 3975181) has the molecular formula C17H12BrF3N4O4 and a molecular weight of 473.21 g/mol. Its IUPAC name is N'-[(4-bromo-3-nitrophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N'-[(4-bromo-3-nitrophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 3975181 |
| Molecular Formula | C17H12BrF3N4O4 |
| Molecular Weight | 473.21 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | N'-[(4-bromo-3-nitrophenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(C(F)(F)F)c1)NN=Cc1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12BrF3N4O4/c18-13-5-4-10(6-14(13)25(28)29)9-22-24-16(27)8-15(26)23-12-3-1-2-11(7-12)17(19,20)21/h1-7,9H,8H2,(H,23,26)(H,24,27) |
| InChIKey | UTOHOOFYZRHVFO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.21 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|