C24H19F3N4O5 — CID 3637819
N'-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 3637819) has the molecular formula C24H19F3N4O5 and a molecular weight of 500.43 g/mol. Its IUPAC name is N'-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N'-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 3637819 |
| Molecular Formula | C24H19F3N4O5 |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N'-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(C(F)(F)F)c1)NN=Cc1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H19F3N4O5/c25-24(26,27)18-2-1-3-19(12-18)29-22(32)13-23(33)30-28-14-16-6-10-21(11-7-16)36-15-17-4-8-20(9-5-17)31(34)35/h1-12,14H,13,15H2,(H,29,32)(H,30,33) |
| InChIKey | QNVAKFPVSHOOMS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|