C23H18Cl2N4O5 — CID 4666995
N-(2,3-dichlorophenyl)-N'-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]propanediamide (PubChem CID 4666995) has the molecular formula C23H18Cl2N4O5 and a molecular weight of 501.33 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 4666995 |
| Molecular Formula | C23H18Cl2N4O5 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)Nc1cccc(Cl)c1Cl)NN=Cc1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H18Cl2N4O5/c24-19-2-1-3-20(23(19)25)27-21(30)12-22(31)28-26-13-15-6-10-18(11-7-15)34-14-16-4-8-17(9-5-16)29(32)33/h1-11,13H,12,14H2,(H,27,30)(H,28,31) |
| InChIKey | ODXZKULGCXVKTC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|