C9H8F3NO4S — CID 5101803
2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propanoic acid (PubChem CID 5101803) has the molecular formula C9H8F3NO4S and a molecular weight of 283.23 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propanoic acid.
| Compound Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propanoic acid |
|---|---|
| PubChem CID | 5101803 |
| Molecular Formula | C9H8F3NO4S |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C9H8F3NO4S/c1-5(8(14)15)18(16,17)7-3-2-6(4-13-7)9(10,11)12/h2-5H,1H3,(H,14,15) |
| InChIKey | IWMPWPHNYBITAN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |