About 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol
4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol (PubChem CID 166282118) has the molecular formula C10H11F3N2O4S
and a molecular weight of 312.27 g/mol. Its IUPAC name is 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol.
Molecular Properties
| Compound Name | 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol |
| PubChem CID | 166282118 |
| Molecular Formula | C10H11F3N2O4S |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol |
| SMILES | CC1(O)CON(S(=O)(=O)c2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C10H11F3N2O4S/c1-9(16)5-15(19-6-9)20(17,18)8-3-2-7(4-14-8)10(11,12)13/h2-4,16H,5-6H2,1H3 |
| InChIKey | PHDNXCPNOJDXRI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol?
The IUPAC name of 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol (CID 166282118) is 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol.
What is the SMILES notation for 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol?
The canonical SMILES for 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol is CC1(O)CON(S(=O)(=O)c2ccc(C(F)(F)F)cn2)C1.
What is the InChIKey of 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol?
The InChIKey is PHDNXCPNOJDXRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O4S/c1-9(16)5-15(19-6-9)20(17,18)8-3-2-7(4-14-8)10(11,12)13/h2-4,16H,5-6H2,1H3.
What are the key properties of 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol?
4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol has a molecular weight of 312.27 g/mol, XLogP of 0.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,2-oxazolidin-4-ol is sourced from PubChem (CID 166282118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).