C12H15F3N2O4S — CID 166283904
7-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,4,7-dioxazonane (PubChem CID 166283904) has the molecular formula C12H15F3N2O4S and a molecular weight of 340.32 g/mol. Its IUPAC name is 7-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,4,7-dioxazonane.
| Compound Name | 7-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,4,7-dioxazonane |
|---|---|
| PubChem CID | 166283904 |
| Molecular Formula | C12H15F3N2O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 7-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]-1,4,7-dioxazonane |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cn1)N1CCOCCOCC1 |
| InChI | InChI=1S/C12H15F3N2O4S/c13-12(14,15)10-1-2-11(16-9-10)22(18,19)17-3-5-20-7-8-21-6-4-17/h1-2,9H,3-8H2 |
| InChIKey | DRMRMZFGBLPJMM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |