C10H12F3N3O — CID 78908037
N-[5-(trifluoromethyl)-2-pyridinyl]morpholin-4-amine (PubChem CID 78908037) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is N-[5-(trifluoromethyl)-2-pyridinyl]morpholin-4-amine.
| Compound Name | N-[5-(trifluoromethyl)-2-pyridinyl]morpholin-4-amine |
|---|---|
| PubChem CID | 78908037 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-[5-(trifluoromethyl)-2-pyridinyl]morpholin-4-amine |
| SMILES | FC(F)(F)c1ccc(NN2CCOCC2)nc1 |
| InChI | InChI=1S/C10H12F3N3O/c11-10(12,13)8-1-2-9(14-7-8)15-16-3-5-17-6-4-16/h1-2,7H,3-6H2,(H,14,15) |
| InChIKey | KYPUIKVBTZDWEE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |