C23H29F3N4O — CID 126539387
N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 126539387) has the molecular formula C23H29F3N4O and a molecular weight of 434.51 g/mol. Its IUPAC name is N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 126539387 |
| Molecular Formula | C23H29F3N4O |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(NCC2(N3CCN(Cc4ccccc4)CC3)CCOCC2)nc1 |
| InChI | InChI=1S/C23H29F3N4O/c24-23(25,26)20-6-7-21(27-16-20)28-18-22(8-14-31-15-9-22)30-12-10-29(11-13-30)17-19-4-2-1-3-5-19/h1-7,16H,8-15,17-18H2,(H,27,28) |
| InChIKey | NEDVSBGFLKYXPJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |