C24H33F3N4O — CID 145237535
N'-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]prop-2-enimidamide (PubChem CID 145237535) has the molecular formula C24H33F3N4O and a molecular weight of 450.55 g/mol. Its IUPAC name is N'-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]prop-2-enimidamide.
| Compound Name | N'-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]prop-2-enimidamide |
|---|---|
| PubChem CID | 145237535 |
| Molecular Formula | C24H33F3N4O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | N'-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-[(Z)-1,1,1-trifluorobut-2-en-2-yl]prop-2-enimidamide |
| SMILES | C=C/C(=N\CC1(N2CCN(Cc3ccccc3)CC2)CCOCC1)N/C(=C\C)C(F)(F)F |
| InChI | InChI=1S/C24H33F3N4O/c1-3-21(24(25,26)27)29-22(4-2)28-19-23(10-16-32-17-11-23)31-14-12-30(13-15-31)18-20-8-6-5-7-9-20/h3-9H,2,10-19H2,1H3,(H,28,29)/b21-3- |
| InChIKey | JQCNWBBRHWVYAE-OSSHXBFKSA-N |
| XLogP | 3.99 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|