C24H39N3O2 — CID 137371452
N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-(2-methylpropyl)propanamide (PubChem CID 137371452) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-(2-methylpropyl)propanamide.
| Compound Name | N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 137371452 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-N-(2-methylpropyl)propanamide |
| SMILES | CCC(=O)N(CC(C)C)CC1(N2CCN(Cc3ccccc3)CC2)CCOCC1 |
| InChI | InChI=1S/C24H39N3O2/c1-4-23(28)26(18-21(2)3)20-24(10-16-29-17-11-24)27-14-12-25(13-15-27)19-22-8-6-5-7-9-22/h5-9,21H,4,10-20H2,1-3H3 |
| InChIKey | TZLGMDLPDWXKAJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |