C26H34FN3O2 — CID 126539476
N-[[4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]methyl]-N-phenylpropanamide (PubChem CID 126539476) has the molecular formula C26H34FN3O2 and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[[4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]methyl]-N-phenylpropanamide.
| Compound Name | N-[[4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]methyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 126539476 |
| Molecular Formula | C26H34FN3O2 |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-[[4-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]oxan-4-yl]methyl]-N-phenylpropanamide |
| SMILES | CCC(=O)N(CC1(N2CCN(Cc3cccc(F)c3)CC2)CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C26H34FN3O2/c1-2-25(31)30(24-9-4-3-5-10-24)21-26(11-17-32-18-12-26)29-15-13-28(14-16-29)20-22-7-6-8-23(27)19-22/h3-10,19H,2,11-18,20-21H2,1H3 |
| InChIKey | ILEWVGBMRKFGRX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |