C28H39N3O — CID 126539534
N-phenyl-N-[[1-[4-(2-phenylethyl)piperazin-1-yl]cyclohexyl]methyl]propanamide (PubChem CID 126539534) has the molecular formula C28H39N3O and a molecular weight of 433.64 g/mol. Its IUPAC name is N-phenyl-N-[[1-[4-(2-phenylethyl)piperazin-1-yl]cyclohexyl]methyl]propanamide.
| Compound Name | N-phenyl-N-[[1-[4-(2-phenylethyl)piperazin-1-yl]cyclohexyl]methyl]propanamide |
|---|---|
| PubChem CID | 126539534 |
| Molecular Formula | C28H39N3O |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | N-phenyl-N-[[1-[4-(2-phenylethyl)piperazin-1-yl]cyclohexyl]methyl]propanamide |
| SMILES | CCC(=O)N(CC1(N2CCN(CCc3ccccc3)CC2)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H39N3O/c1-2-27(32)31(26-14-8-4-9-15-26)24-28(17-10-5-11-18-28)30-22-20-29(21-23-30)19-16-25-12-6-3-7-13-25/h3-4,6-9,12-15H,2,5,10-11,16-24H2,1H3 |
| InChIKey | WTCOWJNAWPDEDT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |