C24H30FN3O — CID 137371237
N-[[1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]cyclopropyl]methyl]-N-phenylpropanamide (PubChem CID 137371237) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is N-[[1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]cyclopropyl]methyl]-N-phenylpropanamide.
| Compound Name | N-[[1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]cyclopropyl]methyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 137371237 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | N-[[1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]cyclopropyl]methyl]-N-phenylpropanamide |
| SMILES | CCC(=O)N(CC1(N2CCN(Cc3ccc(F)cc3)CC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H30FN3O/c1-2-23(29)28(22-6-4-3-5-7-22)19-24(12-13-24)27-16-14-26(15-17-27)18-20-8-10-21(25)11-9-20/h3-11H,2,12-19H2,1H3 |
| InChIKey | PUJDYODHXXZLCQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |