C33H41N3O3 — CID 126509782
N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-2-(2-phenylmethoxyphenyl)propanamide (PubChem CID 126509782) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-2-(2-phenylmethoxyphenyl)propanamide.
| Compound Name | N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-2-(2-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 126509782 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | N-[[4-(4-benzylpiperazin-1-yl)oxan-4-yl]methyl]-2-(2-phenylmethoxyphenyl)propanamide |
| SMILES | CC(C(=O)NCC1(N2CCN(Cc3ccccc3)CC2)CCOCC1)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C33H41N3O3/c1-27(30-14-8-9-15-31(30)39-25-29-12-6-3-7-13-29)32(37)34-26-33(16-22-38-23-17-33)36-20-18-35(19-21-36)24-28-10-4-2-5-11-28/h2-15,27H,16-26H2,1H3,(H,34,37) |
| InChIKey | OULHSSBMJQNKNR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |