C19H28ClN3O — CID 139462048
N-[[1-(4-benzylpiperazin-1-yl)cyclopropyl]methyl]-3-chloro-2-methylpropanamide (PubChem CID 139462048) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is N-[[1-(4-benzylpiperazin-1-yl)cyclopropyl]methyl]-3-chloro-2-methylpropanamide.
| Compound Name | N-[[1-(4-benzylpiperazin-1-yl)cyclopropyl]methyl]-3-chloro-2-methylpropanamide |
|---|---|
| PubChem CID | 139462048 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[[1-(4-benzylpiperazin-1-yl)cyclopropyl]methyl]-3-chloro-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)NCC1(N2CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C19H28ClN3O/c1-16(13-20)18(24)21-15-19(7-8-19)23-11-9-22(10-12-23)14-17-5-3-2-4-6-17/h2-6,16H,7-15H2,1H3,(H,21,24) |
| InChIKey | MIJSUEZZLSDZTG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|