C19H30N4O2 — CID 126507028
N-[[4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]oxan-4-yl]methyl]propanamide (PubChem CID 126507028) has the molecular formula C19H30N4O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[[4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]oxan-4-yl]methyl]propanamide.
| Compound Name | N-[[4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]oxan-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 126507028 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-[[4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]oxan-4-yl]methyl]propanamide |
| SMILES | CCC(=O)NCC1(N2CCN(Cc3ccccn3)CC2)CCOCC1 |
| InChI | InChI=1S/C19H30N4O2/c1-2-18(24)21-16-19(6-13-25-14-7-19)23-11-9-22(10-12-23)15-17-5-3-4-8-20-17/h3-5,8H,2,6-7,9-16H2,1H3,(H,21,24) |
| InChIKey | PLUIMACRAHRLDA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |