C26H34N2O4 — CID 71616252
3,5-dimethyl-N-[(4-morpholin-4-yloxan-4-yl)methyl]-4-phenylmethoxybenzamide (PubChem CID 71616252) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(4-morpholin-4-yloxan-4-yl)methyl]-4-phenylmethoxybenzamide.
| Compound Name | 3,5-dimethyl-N-[(4-morpholin-4-yloxan-4-yl)methyl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 71616252 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 3,5-dimethyl-N-[(4-morpholin-4-yloxan-4-yl)methyl]-4-phenylmethoxybenzamide |
| SMILES | Cc1cc(C(=O)NCC2(N3CCOCC3)CCOCC2)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H34N2O4/c1-20-16-23(17-21(2)24(20)32-18-22-6-4-3-5-7-22)25(29)27-19-26(8-12-30-13-9-26)28-10-14-31-15-11-28/h3-7,16-17H,8-15,18-19H2,1-2H3,(H,27,29) |
| InChIKey | ZMXKPOLDHSASBR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |